C25H23Cl3N2O2 — CID 69372636
N-[1-[bis(4-chlorophenyl)methyl]-5-(hydroxymethyl)pyrrolidin-3-yl]-4-chlorobenzamide (PubChem CID 69372636) has the molecular formula C25H23Cl3N2O2 and a molecular weight of 489.83 g/mol. Its IUPAC name is N-[1-[bis(4-chlorophenyl)methyl]-5-(hydroxymethyl)pyrrolidin-3-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[bis(4-chlorophenyl)methyl]-5-(hydroxymethyl)pyrrolidin-3-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 69372636 |
| Molecular Formula | C25H23Cl3N2O2 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[1-[bis(4-chlorophenyl)methyl]-5-(hydroxymethyl)pyrrolidin-3-yl]-4-chlorobenzamide |
| SMILES | O=C(NC1CC(CO)N(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23Cl3N2O2/c26-19-7-1-16(2-8-19)24(17-3-9-20(27)10-4-17)30-14-22(13-23(30)15-31)29-25(32)18-5-11-21(28)12-6-18/h1-12,22-24,31H,13-15H2,(H,29,32) |
| InChIKey | LSWBJRDCUCGBTN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |