C24H24INO3 — CID 69377753
2-[4-[2-(4-iodophenyl)-3-methylbutan-2-yl]phenoxy]-2-pyridin-2-ylacetic acid (PubChem CID 69377753) has the molecular formula C24H24INO3 and a molecular weight of 501.36 g/mol. Its IUPAC name is 2-[4-[2-(4-iodophenyl)-3-methylbutan-2-yl]phenoxy]-2-pyridin-2-ylacetic acid.
| Compound Name | 2-[4-[2-(4-iodophenyl)-3-methylbutan-2-yl]phenoxy]-2-pyridin-2-ylacetic acid |
|---|---|
| PubChem CID | 69377753 |
| Molecular Formula | C24H24INO3 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 2-[4-[2-(4-iodophenyl)-3-methylbutan-2-yl]phenoxy]-2-pyridin-2-ylacetic acid |
| SMILES | CC(C)C(C)(c1ccc(I)cc1)c1ccc(OC(C(=O)O)c2ccccn2)cc1 |
| InChI | InChI=1S/C24H24INO3/c1-16(2)24(3,17-7-11-19(25)12-8-17)18-9-13-20(14-10-18)29-22(23(27)28)21-6-4-5-15-26-21/h4-16,22H,1-3H3,(H,27,28) |
| InChIKey | XBOGHYDDIZOJSG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|