C25H22F3NO3S — CID 59416696
[4-[3-methyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]butan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 59416696) has the molecular formula C25H22F3NO3S and a molecular weight of 473.52 g/mol. Its IUPAC name is [4-[3-methyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]butan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3-methyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]butan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59416696 |
| Molecular Formula | C25H22F3NO3S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | [4-[3-methyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]butan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)C(C)(c1ccc(C#Cc2ccccn2)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22F3NO3S/c1-18(2)24(3,21-12-15-23(16-13-21)32-33(30,31)25(26,27)28)20-10-7-19(8-11-20)9-14-22-6-4-5-17-29-22/h4-8,10-13,15-18H,1-3H3 |
| InChIKey | VEYHZGCTGSJJBY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|