C37H43F3O5S — CID 160567338
5-[4-[2-(4-tert-butylphenyl)ethynyl]phenyl]-4-methylpentan-2-one;[4-(2-methyl-4-oxopentyl)phenyl] trifluoromethanesulfonate (PubChem CID 160567338) has the molecular formula C37H43F3O5S and a molecular weight of 656.81 g/mol. Its IUPAC name is 5-[4-[2-(4-tert-butylphenyl)ethynyl]phenyl]-4-methylpentan-2-one;[4-(2-methyl-4-oxopentyl)phenyl] trifluoromethanesulfonate.
| Compound Name | 5-[4-[2-(4-tert-butylphenyl)ethynyl]phenyl]-4-methylpentan-2-one;[4-(2-methyl-4-oxopentyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160567338 |
| Molecular Formula | C37H43F3O5S |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | 5-[4-[2-(4-tert-butylphenyl)ethynyl]phenyl]-4-methylpentan-2-one;[4-(2-methyl-4-oxopentyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)CC(C)Cc1ccc(C#Cc2ccc(C(C)(C)C)cc2)cc1.CC(=O)CC(C)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28O.C13H15F3O4S/c1-18(16-19(2)25)17-22-10-8-20(9-11-22)6-7-21-12-14-23(15-13-21)24(3,4)5;1-9(7-10(2)17)8-11-3-5-12(6-4-11)20-21(18,19)13(14,15)16/h8-15,18H,16-17H2,1-5H3;3-6,9H,7-8H2,1-2H3 |
| InChIKey | RACCRXCVHCBJQL-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|