C21H22F3N3O — CID 146944638
4-methyl-5-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]pentan-2-one (PubChem CID 146944638) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-methyl-5-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]pentan-2-one.
| Compound Name | 4-methyl-5-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 146944638 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-methyl-5-[4-[2-[2-(3,3,3-trifluoropropylamino)pyrimidin-5-yl]ethynyl]phenyl]pentan-2-one |
| SMILES | CC(=O)CC(C)Cc1ccc(C#Cc2cnc(NCCC(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C21H22F3N3O/c1-15(11-16(2)28)12-18-6-3-17(4-7-18)5-8-19-13-26-20(27-14-19)25-10-9-21(22,23)24/h3-4,6-7,13-15H,9-12H2,1-2H3,(H,25,26,27) |
| InChIKey | AHOCMRYOVVEHFN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|