C22H23F3NO6S- — CID 154409880
3-[(4-tert-butylbenzoyl)amino]-4-[4-(trifluoromethylsulfonyloxy)phenyl]butanoate (PubChem CID 154409880) has the molecular formula C22H23F3NO6S- and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-[(4-tert-butylbenzoyl)amino]-4-[4-(trifluoromethylsulfonyloxy)phenyl]butanoate.
| Compound Name | 3-[(4-tert-butylbenzoyl)amino]-4-[4-(trifluoromethylsulfonyloxy)phenyl]butanoate |
|---|---|
| PubChem CID | 154409880 |
| Molecular Formula | C22H23F3NO6S- |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 3-[(4-tert-butylbenzoyl)amino]-4-[4-(trifluoromethylsulfonyloxy)phenyl]butanoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(CC(=O)[O-])Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H24F3NO6S/c1-21(2,3)16-8-6-15(7-9-16)20(29)26-17(13-19(27)28)12-14-4-10-18(11-5-14)32-33(30,31)22(23,24)25/h4-11,17H,12-13H2,1-3H3,(H,26,29)(H,27,28)/p-1 |
| InChIKey | QHIYYCRHENLHAF-UHFFFAOYSA-M |
| XLogP | 2.69 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|