C16H16F2N4O2 — CID 69378336
N-cyclopentyl-4-[(2,4-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 69378336) has the molecular formula C16H16F2N4O2 and a molecular weight of 334.33 g/mol. Its IUPAC name is N-cyclopentyl-4-[(2,4-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-cyclopentyl-4-[(2,4-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69378336 |
| Molecular Formula | C16H16F2N4O2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-cyclopentyl-4-[(2,4-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1C(=O)NC1CCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2N4O2/c17-9-5-6-11(12(18)7-9)15(23)21-13-8-19-22-14(13)16(24)20-10-3-1-2-4-10/h5-8,10H,1-4H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | FSPHMPPVMLJNMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |