C27H38N6O5Si — CID 69380741
N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(4,4,7-trimethyl-2,3-dihydro-1H-1,4-benzazasilin-8-yl)oxy]furan-2-carboxamide (PubChem CID 69380741) has the molecular formula C27H38N6O5Si and a molecular weight of 554.72 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(4,4,7-trimethyl-2,3-dihydro-1H-1,4-benzazasilin-8-yl)oxy]furan-2-carboxamide.
| Compound Name | N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(4,4,7-trimethyl-2,3-dihydro-1H-1,4-benzazasilin-8-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 69380741 |
| Molecular Formula | C27H38N6O5Si |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | N-[2-[3-(dimethylamino)propylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(4,4,7-trimethyl-2,3-dihydro-1H-1,4-benzazasilin-8-yl)oxy]furan-2-carboxamide |
| SMILES | COc1nc(NCCCN(C)C)nc(OC)c1NC(=O)c1ccc(Oc2c(C)ccc3c2NCC[Si]3(C)C)o1 |
| InChI | InChI=1S/C27H38N6O5Si/c1-17-9-11-19-21(28-14-16-39(19,6)7)23(17)38-20-12-10-18(37-20)24(34)30-22-25(35-4)31-27(32-26(22)36-5)29-13-8-15-33(2)3/h9-12,28H,8,13-16H2,1-7H3,(H,30,34)(H,29,31,32) |
| InChIKey | QMYAJOHBZZXJIZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|