C23H23NO2S — CID 69397172
3-[hydroxy-(5-methyl-4-phenylthiophen-2-yl)methyl]-1-methyl-4-phenylpyrrolidin-2-one (PubChem CID 69397172) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-[hydroxy-(5-methyl-4-phenylthiophen-2-yl)methyl]-1-methyl-4-phenylpyrrolidin-2-one.
| Compound Name | 3-[hydroxy-(5-methyl-4-phenylthiophen-2-yl)methyl]-1-methyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 69397172 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[hydroxy-(5-methyl-4-phenylthiophen-2-yl)methyl]-1-methyl-4-phenylpyrrolidin-2-one |
| SMILES | Cc1sc(C(O)C2C(=O)N(C)CC2c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C23H23NO2S/c1-15-18(16-9-5-3-6-10-16)13-20(27-15)22(25)21-19(14-24(2)23(21)26)17-11-7-4-8-12-17/h3-13,19,21-22,25H,14H2,1-2H3 |
| InChIKey | AKMNBGLQKIYYDB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |