C21H22N2OS — CID 123577001
(1-methyl-3-phenylpyrrolidin-2-yl)-(5-pyridin-3-ylthiophen-2-yl)methanol (PubChem CID 123577001) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is (1-methyl-3-phenylpyrrolidin-2-yl)-(5-pyridin-3-ylthiophen-2-yl)methanol.
| Compound Name | (1-methyl-3-phenylpyrrolidin-2-yl)-(5-pyridin-3-ylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 123577001 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (1-methyl-3-phenylpyrrolidin-2-yl)-(5-pyridin-3-ylthiophen-2-yl)methanol |
| SMILES | CN1CCC(c2ccccc2)C1C(O)c1ccc(-c2cccnc2)s1 |
| InChI | InChI=1S/C21H22N2OS/c1-23-13-11-17(15-6-3-2-4-7-15)20(23)21(24)19-10-9-18(25-19)16-8-5-12-22-14-16/h2-10,12,14,17,20-21,24H,11,13H2,1H3 |
| InChIKey | YRSKKRMHJIZKCG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |