C14H23FN2+2 — CID 6940165
(3-fluorophenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium (PubChem CID 6940165) has the molecular formula C14H23FN2+2 and a molecular weight of 238.35 g/mol. Its IUPAC name is (3-fluorophenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium.
| Compound Name | (3-fluorophenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
|---|---|
| PubChem CID | 6940165 |
| Molecular Formula | C14H23FN2+2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (3-fluorophenyl)methyl-methyl-(1-methylpiperidin-1-ium-4-yl)azanium |
| SMILES | C[NH+]1CCC([NH+](C)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H21FN2/c1-16-8-6-14(7-9-16)17(2)11-12-4-3-5-13(15)10-12/h3-5,10,14H,6-9,11H2,1-2H3/p+2 |
| InChIKey | QKVBVKDCYFUWPM-UHFFFAOYSA-P |
| XLogP | -0.48 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |