C31H43NSi — CID 69403174
N,N-dihexyl-2-(2-phenylethynyl)-5-(2-trimethylsilylethynyl)aniline (PubChem CID 69403174) has the molecular formula C31H43NSi and a molecular weight of 457.78 g/mol. Its IUPAC name is N,N-dihexyl-2-(2-phenylethynyl)-5-(2-trimethylsilylethynyl)aniline.
| Compound Name | N,N-dihexyl-2-(2-phenylethynyl)-5-(2-trimethylsilylethynyl)aniline |
|---|---|
| PubChem CID | 69403174 |
| Molecular Formula | C31H43NSi |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | N,N-dihexyl-2-(2-phenylethynyl)-5-(2-trimethylsilylethynyl)aniline |
| SMILES | CCCCCCN(CCCCCC)c1cc(C#C[Si](C)(C)C)ccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C31H43NSi/c1-6-8-10-15-24-32(25-16-11-9-7-2)31-27-29(23-26-33(3,4)5)20-22-30(31)21-19-28-17-13-12-14-18-28/h12-14,17-18,20,22,27H,6-11,15-16,24-25H2,1-5H3 |
| InChIKey | JVKCQWUCYBVXCK-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|