C31H27N5O3S2 — CID 69404535
3-[[6-[4-[2-(benzylamino)ethoxy]phenyl]-5-methyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione (PubChem CID 69404535) has the molecular formula C31H27N5O3S2 and a molecular weight of 581.72 g/mol. Its IUPAC name is 3-[[6-[4-[2-(benzylamino)ethoxy]phenyl]-5-methyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione.
| Compound Name | 3-[[6-[4-[2-(benzylamino)ethoxy]phenyl]-5-methyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 69404535 |
| Molecular Formula | C31H27N5O3S2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 3-[[6-[4-[2-(benzylamino)ethoxy]phenyl]-5-methyl-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
| SMILES | CC1=C(Nc2nc(-c3cccs3)nc3sc(-c4ccc(OCCNCc5ccccc5)cc4)c(C)c23)C(=O)NC1=O |
| InChI | InChI=1S/C31H27N5O3S2/c1-18-24-28(33-25-19(2)29(37)36-30(25)38)34-27(23-9-6-16-40-23)35-31(24)41-26(18)21-10-12-22(13-11-21)39-15-14-32-17-20-7-4-3-5-8-20/h3-13,16,32H,14-15,17H2,1-2H3,(H2,33,34,35,36,37,38) |
| InChIKey | UTXORXOWULARBJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|