C22H16N4O3S2 — CID 69402903
3-[[2-(4-methoxyphenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione (PubChem CID 69402903) has the molecular formula C22H16N4O3S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 3-[[2-(4-methoxyphenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione.
| Compound Name | 3-[[2-(4-methoxyphenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 69402903 |
| Molecular Formula | C22H16N4O3S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-[[2-(4-methoxyphenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-4-methylpyrrole-2,5-dione |
| SMILES | COc1ccc(-c2nc(NC3=C(C)C(=O)NC3=O)c3c(-c4cccs4)csc3n2)cc1 |
| InChI | InChI=1S/C22H16N4O3S2/c1-11-17(21(28)26-20(11)27)23-19-16-14(15-4-3-9-30-15)10-31-22(16)25-18(24-19)12-5-7-13(29-2)8-6-12/h3-10H,1-2H3,(H2,23,24,25,26,27,28) |
| InChIKey | NGFIZVIUZXFQQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|