C16H11ClN4S2 — CID 138857572
[2-(4-chlorophenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 138857572) has the molecular formula C16H11ClN4S2 and a molecular weight of 358.88 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 138857572 |
| Molecular Formula | C16H11ClN4S2 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | [2-(4-chlorophenyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(Cl)cc2)nc2scc(-c3cccs3)c12 |
| InChI | InChI=1S/C16H11ClN4S2/c17-10-5-3-9(4-6-10)14-19-15(21-18)13-11(8-23-16(13)20-14)12-2-1-7-22-12/h1-8H,18H2,(H,19,20,21) |
| InChIKey | RFTYJHARNSXPKZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|