C19H12N4O2S3 — CID 69403733
3-methyl-4-[(5-thiophen-2-yl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 69403733) has the molecular formula C19H12N4O2S3 and a molecular weight of 424.53 g/mol. Its IUPAC name is 3-methyl-4-[(5-thiophen-2-yl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 3-methyl-4-[(5-thiophen-2-yl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69403733 |
| Molecular Formula | C19H12N4O2S3 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 3-methyl-4-[(5-thiophen-2-yl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | CC1=C(Nc2nc(-c3ccsc3)nc3scc(-c4cccs4)c23)C(=O)NC1=O |
| InChI | InChI=1S/C19H12N4O2S3/c1-9-14(18(25)23-17(9)24)20-16-13-11(12-3-2-5-27-12)8-28-19(13)22-15(21-16)10-4-6-26-7-10/h2-8H,1H3,(H2,20,21,22,23,24,25) |
| InChIKey | LVMPRACAVOKEBL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|