C15H10N4O2S2 — CID 69404099
3-methyl-4-[(5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 69404099) has the molecular formula C15H10N4O2S2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 3-methyl-4-[(5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 3-methyl-4-[(5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69404099 |
| Molecular Formula | C15H10N4O2S2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 3-methyl-4-[(5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | CC1=C(Nc2ncnc3scc(-c4cccs4)c23)C(=O)NC1=O |
| InChI | InChI=1S/C15H10N4O2S2/c1-7-11(14(21)19-13(7)20)18-12-10-8(9-3-2-4-22-9)5-23-15(10)17-6-16-12/h2-6H,1H3,(H2,16,17,18,19,20,21) |
| InChIKey | TYCQDFPZRFOFAU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|