C13H14N4S3 — CID 62245466
[2-(ethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62245466) has the molecular formula C13H14N4S3 and a molecular weight of 322.48 g/mol. Its IUPAC name is [2-(ethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(ethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62245466 |
| Molecular Formula | C13H14N4S3 |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [2-(ethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCSCc1nc(NN)c2c(-c3cccs3)csc2n1 |
| InChI | InChI=1S/C13H14N4S3/c1-2-18-7-10-15-12(17-14)11-8(6-20-13(11)16-10)9-4-3-5-19-9/h3-6H,2,7,14H2,1H3,(H,15,16,17) |
| InChIKey | XVESKLORAMXDBF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|