C14H15N3OS3 — CID 62189302
2-(2-methoxyethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 62189302) has the molecular formula C14H15N3OS3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(2-methoxyethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62189302 |
| Molecular Formula | C14H15N3OS3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-(2-methoxyethylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCSCc1nc(N)c2c(-c3cccs3)csc2n1 |
| InChI | InChI=1S/C14H15N3OS3/c1-18-4-6-19-8-11-16-13(15)12-9(7-21-14(12)17-11)10-3-2-5-20-10/h2-3,5,7H,4,6,8H2,1H3,(H2,15,16,17) |
| InChIKey | OSKZPLAUMTWWNE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|