C15H17N3S3 — CID 63485868
N-methyl-2-(propylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63485868) has the molecular formula C15H17N3S3 and a molecular weight of 335.52 g/mol. Its IUPAC name is N-methyl-2-(propylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(propylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63485868 |
| Molecular Formula | C15H17N3S3 |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-methyl-2-(propylsulfanylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCSCc1nc(NC)c2c(-c3cccs3)csc2n1 |
| InChI | InChI=1S/C15H17N3S3/c1-3-6-19-9-12-17-14(16-2)13-10(8-21-15(13)18-12)11-5-4-7-20-11/h4-5,7-8H,3,6,9H2,1-2H3,(H,16,17,18) |
| InChIKey | JKWZHAYLACQREM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|