C16H18FNO5 — CID 69408770
1-O-methyl 4-O-prop-2-enyl (2R)-3-acetyl-2-amino-2-(3-fluorophenyl)butanedioate (PubChem CID 69408770) has the molecular formula C16H18FNO5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 1-O-methyl 4-O-prop-2-enyl (2R)-3-acetyl-2-amino-2-(3-fluorophenyl)butanedioate.
| Compound Name | 1-O-methyl 4-O-prop-2-enyl (2R)-3-acetyl-2-amino-2-(3-fluorophenyl)butanedioate |
|---|---|
| PubChem CID | 69408770 |
| Molecular Formula | C16H18FNO5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-O-methyl 4-O-prop-2-enyl (2R)-3-acetyl-2-amino-2-(3-fluorophenyl)butanedioate |
| SMILES | C=CCOC(=O)C(C(C)=O)[C@](N)(C(=O)OC)c1cccc(F)c1 |
| InChI | InChI=1S/C16H18FNO5/c1-4-8-23-14(20)13(10(2)19)16(18,15(21)22-3)11-6-5-7-12(17)9-11/h4-7,9,13H,1,8,18H2,2-3H3/t13?,16-/m0/s1 |
| InChIKey | UXBFWIBFSWRIMG-VYIIXAMBSA-N |
| XLogP | 1.09 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|