C15H17ClNO4- — CID 6941171
(2S)-4-(3-chloro-2-methylanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate (PubChem CID 6941171) has the molecular formula C15H17ClNO4- and a molecular weight of 310.76 g/mol. Its IUPAC name is (2S)-4-(3-chloro-2-methylanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate.
| Compound Name | (2S)-4-(3-chloro-2-methylanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate |
|---|---|
| PubChem CID | 6941171 |
| Molecular Formula | C15H17ClNO4- |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2S)-4-(3-chloro-2-methylanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)C[C@H](C(=O)[O-])[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H18ClNO4/c1-9-11(16)4-2-5-12(9)17-14(18)8-10(15(19)20)13-6-3-7-21-13/h2,4-5,10,13H,3,6-8H2,1H3,(H,17,18)(H,19,20)/p-1/t10-,13-/m0/s1 |
| InChIKey | WDSXTGDPLLZJLV-GWCFXTLKSA-M |
| XLogP | 1.52 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |