C14H15ClNO4- — CID 7769521
(2R)-4-(4-chloroanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate (PubChem CID 7769521) has the molecular formula C14H15ClNO4- and a molecular weight of 296.73 g/mol. Its IUPAC name is (2R)-4-(4-chloroanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate.
| Compound Name | (2R)-4-(4-chloroanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate |
|---|---|
| PubChem CID | 7769521 |
| Molecular Formula | C14H15ClNO4- |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (2R)-4-(4-chloroanilino)-4-oxo-2-[(2S)-oxolan-2-yl]butanoate |
| SMILES | O=C(C[C@@H](C(=O)[O-])[C@@H]1CCCO1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO4/c15-9-3-5-10(6-4-9)16-13(17)8-11(14(18)19)12-2-1-7-20-12/h3-6,11-12H,1-2,7-8H2,(H,16,17)(H,18,19)/p-1/t11-,12+/m1/s1 |
| InChIKey | MEJABMTWTKDDTH-NEPJUHHUSA-M |
| XLogP | 1.21 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |