C27H25BrO4S — CID 69411771
ethyl 2-[1-bromo-6-(3-pentanoyl-1-benzothiophen-2-yl)naphthalen-2-yl]oxyacetate (PubChem CID 69411771) has the molecular formula C27H25BrO4S and a molecular weight of 525.46 g/mol. Its IUPAC name is ethyl 2-[1-bromo-6-(3-pentanoyl-1-benzothiophen-2-yl)naphthalen-2-yl]oxyacetate.
| Compound Name | ethyl 2-[1-bromo-6-(3-pentanoyl-1-benzothiophen-2-yl)naphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 69411771 |
| Molecular Formula | C27H25BrO4S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | ethyl 2-[1-bromo-6-(3-pentanoyl-1-benzothiophen-2-yl)naphthalen-2-yl]oxyacetate |
| SMILES | CCCCC(=O)c1c(-c2ccc3c(Br)c(OCC(=O)OCC)ccc3c2)sc2ccccc12 |
| InChI | InChI=1S/C27H25BrO4S/c1-3-5-9-21(29)25-20-8-6-7-10-23(20)33-27(25)18-11-13-19-17(15-18)12-14-22(26(19)28)32-16-24(30)31-4-2/h6-8,10-15H,3-5,9,16H2,1-2H3 |
| InChIKey | SMPYWMBVZLYFHA-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |