C24H19BrO4S — CID 69410857
ethyl 2-[6-(3-acetyl-1-benzothiophen-2-yl)-1-bromonaphthalen-2-yl]oxyacetate (PubChem CID 69410857) has the molecular formula C24H19BrO4S and a molecular weight of 483.38 g/mol. Its IUPAC name is ethyl 2-[6-(3-acetyl-1-benzothiophen-2-yl)-1-bromonaphthalen-2-yl]oxyacetate.
| Compound Name | ethyl 2-[6-(3-acetyl-1-benzothiophen-2-yl)-1-bromonaphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 69410857 |
| Molecular Formula | C24H19BrO4S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | ethyl 2-[6-(3-acetyl-1-benzothiophen-2-yl)-1-bromonaphthalen-2-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc2cc(-c3sc4ccccc4c3C(C)=O)ccc2c1Br |
| InChI | InChI=1S/C24H19BrO4S/c1-3-28-21(27)13-29-19-11-9-15-12-16(8-10-17(15)23(19)25)24-22(14(2)26)18-6-4-5-7-20(18)30-24/h4-12H,3,13H2,1-2H3 |
| InChIKey | HPNCFPPLMHBDRD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |