C19H18INO4S — CID 2973514
ethyl 2-[4-(1,3-benzothiazol-2-yl)-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 2973514) has the molecular formula C19H18INO4S and a molecular weight of 483.33 g/mol. Its IUPAC name is ethyl 2-[4-(1,3-benzothiazol-2-yl)-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-(1,3-benzothiazol-2-yl)-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 2973514 |
| Molecular Formula | C19H18INO4S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | ethyl 2-[4-(1,3-benzothiazol-2-yl)-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(-c2nc3ccccc3s2)cc1OCC |
| InChI | InChI=1S/C19H18INO4S/c1-3-23-15-10-12(19-21-14-7-5-6-8-16(14)26-19)9-13(20)18(15)25-11-17(22)24-4-2/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | BZLNXALNPOYDKA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|