C13H13ClOS — CID 10354887
4-chloro-1-(2-methyl-1-benzothiophen-3-yl)butan-1-one (PubChem CID 10354887) has the molecular formula C13H13ClOS and a molecular weight of 252.77 g/mol. Its IUPAC name is 4-chloro-1-(2-methyl-1-benzothiophen-3-yl)butan-1-one.
| Compound Name | 4-chloro-1-(2-methyl-1-benzothiophen-3-yl)butan-1-one |
|---|---|
| PubChem CID | 10354887 |
| Molecular Formula | C13H13ClOS |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-chloro-1-(2-methyl-1-benzothiophen-3-yl)butan-1-one |
| SMILES | Cc1sc2ccccc2c1C(=O)CCCCl |
| InChI | InChI=1S/C13H13ClOS/c1-9-13(11(15)6-4-8-14)10-5-2-3-7-12(10)16-9/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | OXCFBYSQZSCFCP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|