C14H15ClN2O3S — CID 70206197
methyl 2-(3-chloropropylcarbamoylamino)-1-benzothiophene-3-carboxylate (PubChem CID 70206197) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is methyl 2-(3-chloropropylcarbamoylamino)-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-(3-chloropropylcarbamoylamino)-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 70206197 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl 2-(3-chloropropylcarbamoylamino)-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)NCCCCl)sc2ccccc12 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-20-13(18)11-9-5-2-3-6-10(9)21-12(11)17-14(19)16-8-4-7-15/h2-3,5-6H,4,7-8H2,1H3,(H2,16,17,19) |
| InChIKey | RBALEGUUKDJOJM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|