C24H34N2O4S — CID 69412413
tert-butyl N-[3-[[(1S,2S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]propanoyl-[(4-methoxyphenyl)methyl]amino]carbamate (PubChem CID 69412413) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1S,2S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]propanoyl-[(4-methoxyphenyl)methyl]amino]carbamate.
| Compound Name | tert-butyl N-[3-[[(1S,2S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]propanoyl-[(4-methoxyphenyl)methyl]amino]carbamate |
|---|---|
| PubChem CID | 69412413 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | tert-butyl N-[3-[[(1S,2S)-2-bicyclo[2.2.1]hept-5-enyl]methylsulfanyl]propanoyl-[(4-methoxyphenyl)methyl]amino]carbamate |
| SMILES | COc1ccc(CN(NC(=O)OC(C)(C)C)C(=O)CCSC[C@H]2CC3C=C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-24(2,3)30-23(28)25-26(15-17-6-9-21(29-4)10-7-17)22(27)11-12-31-16-20-14-18-5-8-19(20)13-18/h5-10,18-20H,11-16H2,1-4H3,(H,25,28)/t18?,19-,20-/m1/s1 |
| InChIKey | OASDBRUQGJLNEB-FXJNCMGBSA-N |
| XLogP | 4.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|