C14H16ClN5OS — CID 69414417
N-[4-(5-chlorothiophen-2-yl)-1-(cyanomethyl)imidazol-2-yl]-2-(propan-2-ylamino)acetamide (PubChem CID 69414417) has the molecular formula C14H16ClN5OS and a molecular weight of 337.84 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1-(cyanomethyl)imidazol-2-yl]-2-(propan-2-ylamino)acetamide.
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1-(cyanomethyl)imidazol-2-yl]-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 69414417 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1-(cyanomethyl)imidazol-2-yl]-2-(propan-2-ylamino)acetamide |
| SMILES | CC(C)NCC(=O)Nc1nc(-c2ccc(Cl)s2)cn1CC#N |
| InChI | InChI=1S/C14H16ClN5OS/c1-9(2)17-7-13(21)19-14-18-10(8-20(14)6-5-16)11-3-4-12(15)22-11/h3-4,8-9,17H,6-7H2,1-2H3,(H,18,19,21) |
| InChIKey | BHNOSXPFMCVQLF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |