C19H29FN2O4S — CID 69414495
tert-butyl N-[2-(4-fluorophenyl)ethylsulfonyl-piperidin-4-ylmethyl]carbamate (PubChem CID 69414495) has the molecular formula C19H29FN2O4S and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-[2-(4-fluorophenyl)ethylsulfonyl-piperidin-4-ylmethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-fluorophenyl)ethylsulfonyl-piperidin-4-ylmethyl]carbamate |
|---|---|
| PubChem CID | 69414495 |
| Molecular Formula | C19H29FN2O4S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | tert-butyl N-[2-(4-fluorophenyl)ethylsulfonyl-piperidin-4-ylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C1CCNCC1)S(=O)(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN2O4S/c1-19(2,3)26-18(23)22-17(15-8-11-21-12-9-15)27(24,25)13-10-14-4-6-16(20)7-5-14/h4-7,15,17,21H,8-13H2,1-3H3,(H,22,23) |
| InChIKey | NCUHHMCXUXIDOE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |