C19H25N2O3+ — CID 6941551
[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 6941551) has the molecular formula C19H25N2O3+ and a molecular weight of 329.42 g/mol. Its IUPAC name is [2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 6941551 |
| Molecular Formula | C19H25N2O3+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | O=C(C[NH2+]C[C@H]1CCCO1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C19H24N2O3/c22-19(13-20-12-17-8-4-10-23-17)21(15-18-9-5-11-24-18)14-16-6-2-1-3-7-16/h1-3,5-7,9,11,17,20H,4,8,10,12-15H2/p+1/t17-/m1/s1 |
| InChIKey | IZEKRMDUAFFPOG-QGZVFWFLSA-O |
| XLogP | 1.55 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |