C23H32N2O5S — CID 4174403
N-benzyl-2-[butylsulfonyl(oxolan-2-ylmethyl)amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 4174403) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-benzyl-2-[butylsulfonyl(oxolan-2-ylmethyl)amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[butylsulfonyl(oxolan-2-ylmethyl)amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4174403 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-benzyl-2-[butylsulfonyl(oxolan-2-ylmethyl)amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCCCS(=O)(=O)N(CC(=O)N(Cc1ccccc1)Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C23H32N2O5S/c1-2-3-15-31(27,28)25(18-22-12-8-14-30-22)19-23(26)24(17-21-11-7-13-29-21)16-20-9-5-4-6-10-20/h4-7,9-11,13,22H,2-3,8,12,14-19H2,1H3 |
| InChIKey | YJGTXZXOHMDBTM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |