C28H41FN2O5S — CID 42773240
N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[octylsulfonyl(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 42773240) has the molecular formula C28H41FN2O5S and a molecular weight of 536.71 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[octylsulfonyl(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[octylsulfonyl(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 42773240 |
| Molecular Formula | C28H41FN2O5S |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[octylsulfonyl(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | CCCCCCCCS(=O)(=O)N(CC(=O)N(Cc1ccc(F)cc1)Cc1ccc(C)o1)CC1CCCO1 |
| InChI | InChI=1S/C28H41FN2O5S/c1-3-4-5-6-7-8-18-37(33,34)31(21-26-10-9-17-35-26)22-28(32)30(20-27-16-11-23(2)36-27)19-24-12-14-25(29)15-13-24/h11-16,26H,3-10,17-22H2,1-2H3 |
| InChIKey | SYPDNFKMZFKEHW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|