C40H59F2N5O5 — CID 69417771
1-N-[(2S,3R)-5-[3-[1-(6-aminohexanoyl)piperidin-4-yl]propanoylamino]-1-(3,5-difluorophenyl)-3-hydroxypentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 69417771) has the molecular formula C40H59F2N5O5 and a molecular weight of 727.94 g/mol. Its IUPAC name is 1-N-[(2S,3R)-5-[3-[1-(6-aminohexanoyl)piperidin-4-yl]propanoylamino]-1-(3,5-difluorophenyl)-3-hydroxypentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-5-[3-[1-(6-aminohexanoyl)piperidin-4-yl]propanoylamino]-1-(3,5-difluorophenyl)-3-hydroxypentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69417771 |
| Molecular Formula | C40H59F2N5O5 |
| Molecular Weight | 727.94 g/mol |
| Exact Mass | 727.45 |
| IUPAC Name | 1-N-[(2S,3R)-5-[3-[1-(6-aminohexanoyl)piperidin-4-yl]propanoylamino]-1-(3,5-difluorophenyl)-3-hydroxypentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CCNC(=O)CCC2CCN(C(=O)CCCCCN)CC2)c1 |
| InChI | InChI=1S/C40H59F2N5O5/c1-4-17-47(18-5-2)40(52)32-22-28(3)21-31(26-32)39(51)45-35(25-30-23-33(41)27-34(42)24-30)36(48)12-16-44-37(49)11-10-29-13-19-46(20-14-29)38(50)9-7-6-8-15-43/h21-24,26-27,29,35-36,48H,4-20,25,43H2,1-3H3,(H,44,49)(H,45,51)/t35-,36+/m0/s1 |
| InChIKey | OJUFXLNSKOLPOO-MPQUPPDSSA-N |
| XLogP | 5.28 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|