C18H19F3N3O+ — CID 6941836
2-piperidin-1-yl-N-[3-(trifluoromethyl)phenyl]pyridin-1-ium-3-carboxamide (PubChem CID 6941836) has the molecular formula C18H19F3N3O+ and a molecular weight of 350.36 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-[3-(trifluoromethyl)phenyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 2-piperidin-1-yl-N-[3-(trifluoromethyl)phenyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 6941836 |
| Molecular Formula | C18H19F3N3O+ |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-piperidin-1-yl-N-[3-(trifluoromethyl)phenyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc[nH+]c1N1CCCCC1 |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)13-6-4-7-14(12-13)23-17(25)15-8-5-9-22-16(15)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11H2,(H,23,25)/p+1 |
| InChIKey | VLFFLWKKPILFSY-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |