C18H17FN2O2 — CID 69420216
ethyl 8-cyano-5-fluoro-3-prop-2-enyl-2,4-dihydro-1H-cyclopenta[b]indole-3-carboxylate (PubChem CID 69420216) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is ethyl 8-cyano-5-fluoro-3-prop-2-enyl-2,4-dihydro-1H-cyclopenta[b]indole-3-carboxylate.
| Compound Name | ethyl 8-cyano-5-fluoro-3-prop-2-enyl-2,4-dihydro-1H-cyclopenta[b]indole-3-carboxylate |
|---|---|
| PubChem CID | 69420216 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl 8-cyano-5-fluoro-3-prop-2-enyl-2,4-dihydro-1H-cyclopenta[b]indole-3-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCc2c1[nH]c1c(F)ccc(C#N)c21 |
| InChI | InChI=1S/C18H17FN2O2/c1-3-8-18(17(22)23-4-2)9-7-12-14-11(10-20)5-6-13(19)15(14)21-16(12)18/h3,5-6,21H,1,4,7-9H2,2H3 |
| InChIKey | DIHYXHGXYVPFNR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|