C26H42N2O2Si — CID 69423236
2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)-N-[heptyl(dimethyl)silyl]acetamide (PubChem CID 69423236) has the molecular formula C26H42N2O2Si and a molecular weight of 442.72 g/mol. Its IUPAC name is 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)-N-[heptyl(dimethyl)silyl]acetamide.
| Compound Name | 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)-N-[heptyl(dimethyl)silyl]acetamide |
|---|---|
| PubChem CID | 69423236 |
| Molecular Formula | C26H42N2O2Si |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)-N-[heptyl(dimethyl)silyl]acetamide |
| SMILES | CCCCCCC[Si](C)(C)NC(=O)CC1(CC)OCCc2c1[nH]c1c(CC)cccc21 |
| InChI | InChI=1S/C26H42N2O2Si/c1-6-9-10-11-12-18-31(4,5)28-23(29)19-26(8-3)25-22(16-17-30-26)21-15-13-14-20(7-2)24(21)27-25/h13-15,27H,6-12,16-19H2,1-5H3,(H,28,29) |
| InChIKey | GEYDDAJTRJQAFD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|