C22H31NO3 — CID 42613324
pentyl 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (PubChem CID 42613324) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is pentyl 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate.
| Compound Name | pentyl 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
|---|---|
| PubChem CID | 42613324 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | pentyl 2-(1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| SMILES | CCCCCOC(=O)CC1(CC)OCCc2c1[nH]c1c(CC)cccc21 |
| InChI | InChI=1S/C22H31NO3/c1-4-7-8-13-25-19(24)15-22(6-3)21-18(12-14-26-22)17-11-9-10-16(5-2)20(17)23-21/h9-11,23H,4-8,12-15H2,1-3H3 |
| InChIKey | WLAPAGIARXTNBH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|