C16H17Cl2NO3 — CID 11953352
ethyl 2-[6-chloro-1-(chloromethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetate (PubChem CID 11953352) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is ethyl 2-[6-chloro-1-(chloromethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetate.
| Compound Name | ethyl 2-[6-chloro-1-(chloromethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetate |
|---|---|
| PubChem CID | 11953352 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | ethyl 2-[6-chloro-1-(chloromethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetate |
| SMILES | CCOC(=O)CC1(CCl)OCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C16H17Cl2NO3/c1-2-21-14(20)8-16(9-17)15-11(5-6-22-16)12-7-10(18)3-4-13(12)19-15/h3-4,7,19H,2,5-6,8-9H2,1H3 |
| InChIKey | RJYOPSYFXRHNEB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|