C22H25Cl2N3O3S — CID 69423489
N-[2-(4-cyanophenyl)ethyl]-4-[(2,3-dichlorophenyl)sulfonylmethylamino]-N-ethylbutanamide (PubChem CID 69423489) has the molecular formula C22H25Cl2N3O3S and a molecular weight of 482.43 g/mol. Its IUPAC name is N-[2-(4-cyanophenyl)ethyl]-4-[(2,3-dichlorophenyl)sulfonylmethylamino]-N-ethylbutanamide.
| Compound Name | N-[2-(4-cyanophenyl)ethyl]-4-[(2,3-dichlorophenyl)sulfonylmethylamino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 69423489 |
| Molecular Formula | C22H25Cl2N3O3S |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[2-(4-cyanophenyl)ethyl]-4-[(2,3-dichlorophenyl)sulfonylmethylamino]-N-ethylbutanamide |
| SMILES | CCN(CCc1ccc(C#N)cc1)C(=O)CCCNCS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H25Cl2N3O3S/c1-2-27(14-12-17-8-10-18(15-25)11-9-17)21(28)7-4-13-26-16-31(29,30)20-6-3-5-19(23)22(20)24/h3,5-6,8-11,26H,2,4,7,12-14,16H2,1H3 |
| InChIKey | BQQRIFDDSUKGOA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|