C20H21Cl2N3O3S — CID 69421856
N-[2-(4-cyanophenyl)ethyl]-3-[(2,5-dichlorophenyl)sulfonylmethylamino]-N-methylpropanamide (PubChem CID 69421856) has the molecular formula C20H21Cl2N3O3S and a molecular weight of 454.38 g/mol. Its IUPAC name is N-[2-(4-cyanophenyl)ethyl]-3-[(2,5-dichlorophenyl)sulfonylmethylamino]-N-methylpropanamide.
| Compound Name | N-[2-(4-cyanophenyl)ethyl]-3-[(2,5-dichlorophenyl)sulfonylmethylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 69421856 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[2-(4-cyanophenyl)ethyl]-3-[(2,5-dichlorophenyl)sulfonylmethylamino]-N-methylpropanamide |
| SMILES | CN(CCc1ccc(C#N)cc1)C(=O)CCNCS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O3S/c1-25(11-9-15-2-4-16(13-23)5-3-15)20(26)8-10-24-14-29(27,28)19-12-17(21)6-7-18(19)22/h2-7,12,24H,8-11,14H2,1H3 |
| InChIKey | HEZWFAMXHDCEQP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|