C23H26O6 — CID 69425280
(2S)-3-[4-[3-(2-acetylphenoxy)cyclopentyl]oxyphenyl]-2-methoxypropanoic acid (PubChem CID 69425280) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2S)-3-[4-[3-(2-acetylphenoxy)cyclopentyl]oxyphenyl]-2-methoxypropanoic acid.
| Compound Name | (2S)-3-[4-[3-(2-acetylphenoxy)cyclopentyl]oxyphenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 69425280 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2S)-3-[4-[3-(2-acetylphenoxy)cyclopentyl]oxyphenyl]-2-methoxypropanoic acid |
| SMILES | CO[C@@H](Cc1ccc(OC2CCC(Oc3ccccc3C(C)=O)C2)cc1)C(=O)O |
| InChI | InChI=1S/C23H26O6/c1-15(24)20-5-3-4-6-21(20)29-19-12-11-18(14-19)28-17-9-7-16(8-10-17)13-22(27-2)23(25)26/h3-10,18-19,22H,11-14H2,1-2H3,(H,25,26)/t18?,19?,22-/m0/s1 |
| InChIKey | STNQQPNOFFELLJ-AJTFCVKESA-N |
| XLogP | 3.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |