C29H36O5 — CID 142194269
3-(4-cyclopentyloxyphenyl)-2-methoxypropanoic acid;ethane;4-phenylphenol (PubChem CID 142194269) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 3-(4-cyclopentyloxyphenyl)-2-methoxypropanoic acid;ethane;4-phenylphenol.
| Compound Name | 3-(4-cyclopentyloxyphenyl)-2-methoxypropanoic acid;ethane;4-phenylphenol |
|---|---|
| PubChem CID | 142194269 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 3-(4-cyclopentyloxyphenyl)-2-methoxypropanoic acid;ethane;4-phenylphenol |
| SMILES | CC.COC(Cc1ccc(OC2CCCC2)cc1)C(=O)O.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H20O4.C12H10O.C2H6/c1-18-14(15(16)17)10-11-6-8-13(9-7-11)19-12-4-2-3-5-12;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2/h6-9,12,14H,2-5,10H2,1H3,(H,16,17);1-9,13H;1-2H3 |
| InChIKey | YNKJUXLXULIFGF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |