C20H18FN3 — CID 69426394
3-[1-ethyl-5-[2-(4-fluorophenyl)ethyl]pyrazol-3-yl]benzonitrile (PubChem CID 69426394) has the molecular formula C20H18FN3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 3-[1-ethyl-5-[2-(4-fluorophenyl)ethyl]pyrazol-3-yl]benzonitrile.
| Compound Name | 3-[1-ethyl-5-[2-(4-fluorophenyl)ethyl]pyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 69426394 |
| Molecular Formula | C20H18FN3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-[1-ethyl-5-[2-(4-fluorophenyl)ethyl]pyrazol-3-yl]benzonitrile |
| SMILES | CCn1nc(-c2cccc(C#N)c2)cc1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FN3/c1-2-24-19(11-8-15-6-9-18(21)10-7-15)13-20(23-24)17-5-3-4-16(12-17)14-22/h3-7,9-10,12-13H,2,8,11H2,1H3 |
| InChIKey | MSPMAEPZRMZGTH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |