About 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate
2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate (PubChem CID 6942729) has the molecular formula C14H15O3-
and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate.
Molecular Properties
| Compound Name | 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate |
| PubChem CID | 6942729 |
| Molecular Formula | C14H15O3- |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate |
| SMILES | O=C([O-])C[C@H]1CCC[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C14H16O3/c15-13(16)9-11-7-4-8-12(14(11)17)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,16)/p-1/t11-,12+/m1/s1 |
| InChIKey | WTBDYAFOVHATCN-NEPJUHHUSA-M |
| XLogP | 1.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate?
The IUPAC name of 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate (CID 6942729) is 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate.
What is the SMILES notation for 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate?
The canonical SMILES for 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate is O=C([O-])C[C@H]1CCC[C@@H](c2ccccc2)C1=O.
What is the InChIKey of 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate?
The InChIKey is WTBDYAFOVHATCN-NEPJUHHUSA-M. The full InChI is InChI=1S/C14H16O3/c15-13(16)9-11-7-4-8-12(14(11)17)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,15,16)/p-1/t11-,12+/m1/s1.
What are the key properties of 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate?
2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate has a molecular weight of 231.27 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3S)-2-oxo-3-phenylcyclohexyl]acetate is sourced from PubChem (CID 6942729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).