C32H29N5O3 — CID 69427319
4-cyano-3-methyl-2-[1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]benzamide (PubChem CID 69427319) has the molecular formula C32H29N5O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is 4-cyano-3-methyl-2-[1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]benzamide.
| Compound Name | 4-cyano-3-methyl-2-[1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 69427319 |
| Molecular Formula | C32H29N5O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-cyano-3-methyl-2-[1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]benzamide |
| SMILES | Cc1c(C#N)ccc(C(N)=O)c1C1CCN(c2ccc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)C1 |
| InChI | InChI=1S/C32H29N5O3/c1-21-22(19-33)7-16-29(31(34)38)30(21)23-17-18-37(20-23)26-12-8-24(9-13-26)35-32(39)36-25-10-14-28(15-11-25)40-27-5-3-2-4-6-27/h2-16,23H,17-18,20H2,1H3,(H2,34,38)(H2,35,36,39) |
| InChIKey | NAMZCILUWIGUSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|