C24H24N4O3 — CID 91807695
1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidine-2-carboxamide (PubChem CID 91807695) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91807695 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[4-[(4-phenoxyphenyl)carbamoylamino]phenyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1c1ccc(NC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c25-23(29)22-7-4-16-28(22)19-12-8-17(9-13-19)26-24(30)27-18-10-14-21(15-11-18)31-20-5-2-1-3-6-20/h1-3,5-6,8-15,22H,4,7,16H2,(H2,25,29)(H2,26,27,30) |
| InChIKey | ALVSBDRVZPHIFV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |