C27H35NO4 — CID 69428656
4-[2-(azepan-1-yl)ethoxy]-3-oxo-7,7-diphenylheptanoic acid (PubChem CID 69428656) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)ethoxy]-3-oxo-7,7-diphenylheptanoic acid.
| Compound Name | 4-[2-(azepan-1-yl)ethoxy]-3-oxo-7,7-diphenylheptanoic acid |
|---|---|
| PubChem CID | 69428656 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 4-[2-(azepan-1-yl)ethoxy]-3-oxo-7,7-diphenylheptanoic acid |
| SMILES | O=C(O)CC(=O)C(CCC(c1ccccc1)c1ccccc1)OCCN1CCCCCC1 |
| InChI | InChI=1S/C27H35NO4/c29-25(21-27(30)31)26(32-20-19-28-17-9-1-2-10-18-28)16-15-24(22-11-5-3-6-12-22)23-13-7-4-8-14-23/h3-8,11-14,24,26H,1-2,9-10,15-21H2,(H,30,31) |
| InChIKey | LWCJAWAQYMAMNV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|