C19H38Cl2N2 — CID 69431994
1-(1,3-dicyclohexylpropan-2-yl)piperazine;dihydrochloride (PubChem CID 69431994) has the molecular formula C19H38Cl2N2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-(1,3-dicyclohexylpropan-2-yl)piperazine;dihydrochloride.
| Compound Name | 1-(1,3-dicyclohexylpropan-2-yl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 69431994 |
| Molecular Formula | C19H38Cl2N2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-(1,3-dicyclohexylpropan-2-yl)piperazine;dihydrochloride |
| SMILES | C1CCC(CC(CC2CCCCC2)N2CCNCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H36N2.2ClH/c1-3-7-17(8-4-1)15-19(21-13-11-20-12-14-21)16-18-9-5-2-6-10-18;;/h17-20H,1-16H2;2*1H |
| InChIKey | JRHAVTNOQWCSAN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |